C13H24N2 — CID 156850242
ethane;3-methyl-N-(pyridin-4-ylmethyl)butan-1-amine (PubChem CID 156850242) has the molecular formula C13H24N2 and a molecular weight of 208.35 g/mol. Its IUPAC name is ethane;3-methyl-N-(pyridin-4-ylmethyl)butan-1-amine.
| Compound Name | ethane;3-methyl-N-(pyridin-4-ylmethyl)butan-1-amine |
|---|---|
| PubChem CID | 156850242 |
| Molecular Formula | C13H24N2 |
| Molecular Weight | 208.35 g/mol |
| Exact Mass | 208.19 |
| IUPAC Name | ethane;3-methyl-N-(pyridin-4-ylmethyl)butan-1-amine |
| SMILES | CC.CC(C)CCNCc1ccncc1 |
| InChI | InChI=1S/C11H18N2.C2H6/c1-10(2)3-6-13-9-11-4-7-12-8-5-11;1-2/h4-5,7-8,10,13H,3,6,9H2,1-2H3;1-2H3 |
| InChIKey | QTLCBKDUOHUSLB-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.35 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|