C12H21ClN2O — CID 17206477
3-propan-2-yloxy-N-(pyridin-4-ylmethyl)propan-1-amine;hydrochloride (PubChem CID 17206477) has the molecular formula C12H21ClN2O and a molecular weight of 244.77 g/mol. Its IUPAC name is 3-propan-2-yloxy-N-(pyridin-4-ylmethyl)propan-1-amine;hydrochloride.
| Compound Name | 3-propan-2-yloxy-N-(pyridin-4-ylmethyl)propan-1-amine;hydrochloride |
|---|---|
| PubChem CID | 17206477 |
| Molecular Formula | C12H21ClN2O |
| Molecular Weight | 244.77 g/mol |
| Exact Mass | 244.13 |
| IUPAC Name | 3-propan-2-yloxy-N-(pyridin-4-ylmethyl)propan-1-amine;hydrochloride |
| SMILES | CC(C)OCCCNCc1ccncc1.Cl |
| InChI | InChI=1S/C12H20N2O.ClH/c1-11(2)15-9-3-6-14-10-12-4-7-13-8-5-12;/h4-5,7-8,11,14H,3,6,9-10H2,1-2H3;1H |
| InChIKey | WDJHQAYCTRMKKK-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.77 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|