C17H31NOSi — CID 106009810
4-propan-2-yloxy-N-[(4-trimethylsilylphenyl)methyl]butan-1-amine (PubChem CID 106009810) has the molecular formula C17H31NOSi and a molecular weight of 293.53 g/mol. Its IUPAC name is 4-propan-2-yloxy-N-[(4-trimethylsilylphenyl)methyl]butan-1-amine.
| Compound Name | 4-propan-2-yloxy-N-[(4-trimethylsilylphenyl)methyl]butan-1-amine |
|---|---|
| PubChem CID | 106009810 |
| Molecular Formula | C17H31NOSi |
| Molecular Weight | 293.53 g/mol |
| Exact Mass | 293.22 |
| IUPAC Name | 4-propan-2-yloxy-N-[(4-trimethylsilylphenyl)methyl]butan-1-amine |
| SMILES | CC(C)OCCCCNCc1ccc([Si](C)(C)C)cc1 |
| InChI | InChI=1S/C17H31NOSi/c1-15(2)19-13-7-6-12-18-14-16-8-10-17(11-9-16)20(3,4)5/h8-11,15,18H,6-7,12-14H2,1-5H3 |
| InChIKey | HCYPZAUQJFHYSK-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.53 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|