C12H22N2Si — CID 103437754
N'-[(4-trimethylsilylphenyl)methyl]ethane-1,2-diamine (PubChem CID 103437754) has the molecular formula C12H22N2Si and a molecular weight of 222.41 g/mol. Its IUPAC name is N'-[(4-trimethylsilylphenyl)methyl]ethane-1,2-diamine.
| Compound Name | N'-[(4-trimethylsilylphenyl)methyl]ethane-1,2-diamine |
|---|---|
| PubChem CID | 103437754 |
| Molecular Formula | C12H22N2Si |
| Molecular Weight | 222.41 g/mol |
| Exact Mass | 222.16 |
| IUPAC Name | N'-[(4-trimethylsilylphenyl)methyl]ethane-1,2-diamine |
| SMILES | C[Si](C)(C)c1ccc(CNCCN)cc1 |
| InChI | InChI=1S/C12H22N2Si/c1-15(2,3)12-6-4-11(5-7-12)10-14-9-8-13/h4-7,14H,8-10,13H2,1-3H3 |
| InChIKey | JYLGLUFSTGSVEQ-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.41 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|