C14H26N2O2SSi — CID 106336342
N-[3-[(4-trimethylsilylphenyl)methylamino]propyl]methanesulfonamide (PubChem CID 106336342) has the molecular formula C14H26N2O2SSi and a molecular weight of 314.53 g/mol. Its IUPAC name is N-[3-[(4-trimethylsilylphenyl)methylamino]propyl]methanesulfonamide.
| Compound Name | N-[3-[(4-trimethylsilylphenyl)methylamino]propyl]methanesulfonamide |
|---|---|
| PubChem CID | 106336342 |
| Molecular Formula | C14H26N2O2SSi |
| Molecular Weight | 314.53 g/mol |
| Exact Mass | 314.15 |
| IUPAC Name | N-[3-[(4-trimethylsilylphenyl)methylamino]propyl]methanesulfonamide |
| SMILES | C[Si](C)(C)c1ccc(CNCCCNS(C)(=O)=O)cc1 |
| InChI | InChI=1S/C14H26N2O2SSi/c1-19(17,18)16-11-5-10-15-12-13-6-8-14(9-7-13)20(2,3)4/h6-9,15-16H,5,10-12H2,1-4H3 |
| InChIKey | WKDWRLVFNWZXQD-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.53 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|