C14H26N2O2Si — CID 20829624
N'-[[4-[2-[dimethoxy(methyl)silyl]ethyl]phenyl]methyl]ethane-1,2-diamine (PubChem CID 20829624) has the molecular formula C14H26N2O2Si and a molecular weight of 282.46 g/mol. Its IUPAC name is N'-[[4-[2-[dimethoxy(methyl)silyl]ethyl]phenyl]methyl]ethane-1,2-diamine.
| Compound Name | N'-[[4-[2-[dimethoxy(methyl)silyl]ethyl]phenyl]methyl]ethane-1,2-diamine |
|---|---|
| PubChem CID | 20829624 |
| Molecular Formula | C14H26N2O2Si |
| Molecular Weight | 282.46 g/mol |
| Exact Mass | 282.18 |
| IUPAC Name | N'-[[4-[2-[dimethoxy(methyl)silyl]ethyl]phenyl]methyl]ethane-1,2-diamine |
| SMILES | CO[Si](C)(CCc1ccc(CNCCN)cc1)OC |
| InChI | InChI=1S/C14H26N2O2Si/c1-17-19(3,18-2)11-8-13-4-6-14(7-5-13)12-16-10-9-15/h4-7,16H,8-12,15H2,1-3H3 |
| InChIKey | AFQASUAYCZAWBX-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 56.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.46 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|