C10H19N3O — CID 43662494
3-propan-2-yloxy-N-(1H-pyrazol-5-ylmethyl)propan-1-amine (PubChem CID 43662494) has the molecular formula C10H19N3O and a molecular weight of 197.28 g/mol. Its IUPAC name is 3-propan-2-yloxy-N-(1H-pyrazol-5-ylmethyl)propan-1-amine.
| Compound Name | 3-propan-2-yloxy-N-(1H-pyrazol-5-ylmethyl)propan-1-amine |
|---|---|
| PubChem CID | 43662494 |
| Molecular Formula | C10H19N3O |
| Molecular Weight | 197.28 g/mol |
| Exact Mass | 197.15 |
| IUPAC Name | 3-propan-2-yloxy-N-(1H-pyrazol-5-ylmethyl)propan-1-amine |
| SMILES | CC(C)OCCCNCc1ccn[nH]1 |
| InChI | InChI=1S/C10H19N3O/c1-9(2)14-7-3-5-11-8-10-4-6-12-13-10/h4,6,9,11H,3,5,7-8H2,1-2H3,(H,12,13) |
| InChIKey | JFAGBZWRKORNCL-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 49.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.28 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|