C9H18N4O2S — CID 115607773
N-[3-(1H-pyrazol-5-ylmethylamino)propyl]ethanesulfonamide (PubChem CID 115607773) has the molecular formula C9H18N4O2S and a molecular weight of 246.34 g/mol. Its IUPAC name is N-[3-(1H-pyrazol-5-ylmethylamino)propyl]ethanesulfonamide.
| Compound Name | N-[3-(1H-pyrazol-5-ylmethylamino)propyl]ethanesulfonamide |
|---|---|
| PubChem CID | 115607773 |
| Molecular Formula | C9H18N4O2S |
| Molecular Weight | 246.34 g/mol |
| Exact Mass | 246.12 |
| IUPAC Name | N-[3-(1H-pyrazol-5-ylmethylamino)propyl]ethanesulfonamide |
| SMILES | CCS(=O)(=O)NCCCNCc1ccn[nH]1 |
| InChI | InChI=1S/C9H18N4O2S/c1-2-16(14,15)12-6-3-5-10-8-9-4-7-11-13-9/h4,7,10,12H,2-3,5-6,8H2,1H3,(H,11,13) |
| InChIKey | KFZOOSLQPVPPNE-UHFFFAOYSA-N |
| XLogP | -0.17 |
| TPSA | 86.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.34 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|