C6H10ClN3O2S — CID 107651745
2-chloro-N-(1H-pyrazol-5-ylmethyl)ethanesulfonamide (PubChem CID 107651745) has the molecular formula C6H10ClN3O2S and a molecular weight of 223.68 g/mol. Its IUPAC name is 2-chloro-N-(1H-pyrazol-5-ylmethyl)ethanesulfonamide.
| Compound Name | 2-chloro-N-(1H-pyrazol-5-ylmethyl)ethanesulfonamide |
|---|---|
| PubChem CID | 107651745 |
| Molecular Formula | C6H10ClN3O2S |
| Molecular Weight | 223.68 g/mol |
| Exact Mass | 223.02 |
| IUPAC Name | 2-chloro-N-(1H-pyrazol-5-ylmethyl)ethanesulfonamide |
| SMILES | O=S(=O)(CCCl)NCc1ccn[nH]1 |
| InChI | InChI=1S/C6H10ClN3O2S/c7-2-4-13(11,12)9-5-6-1-3-8-10-6/h1,3,9H,2,4-5H2,(H,8,10) |
| InChIKey | QZVAWQUVKIDSFA-UHFFFAOYSA-N |
| XLogP | 0.07 |
| TPSA | 74.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.68 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|