C9H14ClN3O — CID 61285695
5-chloro-N-(1H-pyrazol-5-ylmethyl)pentanamide (PubChem CID 61285695) has the molecular formula C9H14ClN3O and a molecular weight of 215.68 g/mol. Its IUPAC name is 5-chloro-N-(1H-pyrazol-5-ylmethyl)pentanamide.
| Compound Name | 5-chloro-N-(1H-pyrazol-5-ylmethyl)pentanamide |
|---|---|
| PubChem CID | 61285695 |
| Molecular Formula | C9H14ClN3O |
| Molecular Weight | 215.68 g/mol |
| Exact Mass | 215.08 |
| IUPAC Name | 5-chloro-N-(1H-pyrazol-5-ylmethyl)pentanamide |
| SMILES | O=C(CCCCCl)NCc1ccn[nH]1 |
| InChI | InChI=1S/C9H14ClN3O/c10-5-2-1-3-9(14)11-7-8-4-6-12-13-8/h4,6H,1-3,5,7H2,(H,11,14)(H,12,13) |
| InChIKey | RWLSKWUEPSMQOT-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.68 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|