C11H9ClN4O2S — CID 61284926
5-chloro-2-cyano-N-(1H-pyrazol-5-ylmethyl)benzenesulfonamide (PubChem CID 61284926) has the molecular formula C11H9ClN4O2S and a molecular weight of 296.74 g/mol. Its IUPAC name is 5-chloro-2-cyano-N-(1H-pyrazol-5-ylmethyl)benzenesulfonamide.
| Compound Name | 5-chloro-2-cyano-N-(1H-pyrazol-5-ylmethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 61284926 |
| Molecular Formula | C11H9ClN4O2S |
| Molecular Weight | 296.74 g/mol |
| Exact Mass | 296.01 |
| IUPAC Name | 5-chloro-2-cyano-N-(1H-pyrazol-5-ylmethyl)benzenesulfonamide |
| SMILES | N#Cc1ccc(Cl)cc1S(=O)(=O)NCc1ccn[nH]1 |
| InChI | InChI=1S/C11H9ClN4O2S/c12-9-2-1-8(6-13)11(5-9)19(17,18)15-7-10-3-4-14-16-10/h1-5,15H,7H2,(H,14,16) |
| InChIKey | HPFFOLHHQPIAMQ-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 98.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.74 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |