C10H19N3O2S — CID 115625744
2-tert-butylsulfonyl-N-(1H-pyrazol-5-ylmethyl)ethanamine (PubChem CID 115625744) has the molecular formula C10H19N3O2S and a molecular weight of 245.35 g/mol. Its IUPAC name is 2-tert-butylsulfonyl-N-(1H-pyrazol-5-ylmethyl)ethanamine.
| Compound Name | 2-tert-butylsulfonyl-N-(1H-pyrazol-5-ylmethyl)ethanamine |
|---|---|
| PubChem CID | 115625744 |
| Molecular Formula | C10H19N3O2S |
| Molecular Weight | 245.35 g/mol |
| Exact Mass | 245.12 |
| IUPAC Name | 2-tert-butylsulfonyl-N-(1H-pyrazol-5-ylmethyl)ethanamine |
| SMILES | CC(C)(C)S(=O)(=O)CCNCc1ccn[nH]1 |
| InChI | InChI=1S/C10H19N3O2S/c1-10(2,3)16(14,15)7-6-11-8-9-4-5-12-13-9/h4-5,11H,6-8H2,1-3H3,(H,12,13) |
| InChIKey | PZXKUZOUYGFMNR-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 74.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.35 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|