C7H14N4O2S — CID 43662504
N-[2-(1H-pyrazol-5-ylmethylamino)ethyl]methanesulfonamide (PubChem CID 43662504) has the molecular formula C7H14N4O2S and a molecular weight of 218.28 g/mol. Its IUPAC name is N-[2-(1H-pyrazol-5-ylmethylamino)ethyl]methanesulfonamide.
| Compound Name | N-[2-(1H-pyrazol-5-ylmethylamino)ethyl]methanesulfonamide |
|---|---|
| PubChem CID | 43662504 |
| Molecular Formula | C7H14N4O2S |
| Molecular Weight | 218.28 g/mol |
| Exact Mass | 218.08 |
| IUPAC Name | N-[2-(1H-pyrazol-5-ylmethylamino)ethyl]methanesulfonamide |
| SMILES | CS(=O)(=O)NCCNCc1ccn[nH]1 |
| InChI | InChI=1S/C7H14N4O2S/c1-14(12,13)10-5-4-8-6-7-2-3-9-11-7/h2-3,8,10H,4-6H2,1H3,(H,9,11) |
| InChIKey | HJODEXUEPTVDCK-UHFFFAOYSA-N |
| XLogP | -0.95 |
| TPSA | 86.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.28 |
| LogP ≤ 5 | -0.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|