C8H13N3 — CID 114615875
2-methyl-N-(1H-pyrazol-5-ylmethyl)prop-2-en-1-amine (PubChem CID 114615875) has the molecular formula C8H13N3 and a molecular weight of 151.21 g/mol. Its IUPAC name is 2-methyl-N-(1H-pyrazol-5-ylmethyl)prop-2-en-1-amine.
| Compound Name | 2-methyl-N-(1H-pyrazol-5-ylmethyl)prop-2-en-1-amine |
|---|---|
| PubChem CID | 114615875 |
| Molecular Formula | C8H13N3 |
| Molecular Weight | 151.21 g/mol |
| Exact Mass | 151.11 |
| IUPAC Name | 2-methyl-N-(1H-pyrazol-5-ylmethyl)prop-2-en-1-amine |
| SMILES | C=C(C)CNCc1ccn[nH]1 |
| InChI | InChI=1S/C8H13N3/c1-7(2)5-9-6-8-3-4-10-11-8/h3-4,9H,1,5-6H2,2H3,(H,10,11) |
| InChIKey | IUQYQDAIFFHERN-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 40.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 151.21 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|