C10H18N2O3S2 — CID 106381142
4-[(2-tert-butylsulfonylethylamino)methyl]-3H-1,3-thiazol-2-one (PubChem CID 106381142) has the molecular formula C10H18N2O3S2 and a molecular weight of 278.40 g/mol. Its IUPAC name is 4-[(2-tert-butylsulfonylethylamino)methyl]-3H-1,3-thiazol-2-one.
| Compound Name | 4-[(2-tert-butylsulfonylethylamino)methyl]-3H-1,3-thiazol-2-one |
|---|---|
| PubChem CID | 106381142 |
| Molecular Formula | C10H18N2O3S2 |
| Molecular Weight | 278.40 g/mol |
| Exact Mass | 278.08 |
| IUPAC Name | 4-[(2-tert-butylsulfonylethylamino)methyl]-3H-1,3-thiazol-2-one |
| SMILES | CC(C)(C)S(=O)(=O)CCNCc1csc(=O)[nH]1 |
| InChI | InChI=1S/C10H18N2O3S2/c1-10(2,3)17(14,15)5-4-11-6-8-7-16-9(13)12-8/h7,11H,4-6H2,1-3H3,(H,12,13) |
| InChIKey | VEOOAAZCGTUDCF-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 79.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.40 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|