C8H15N3O2S — CID 106381718
4-[[2-(2-aminoethoxy)ethylamino]methyl]-3H-1,3-thiazol-2-one (PubChem CID 106381718) has the molecular formula C8H15N3O2S and a molecular weight of 217.29 g/mol. Its IUPAC name is 4-[[2-(2-aminoethoxy)ethylamino]methyl]-3H-1,3-thiazol-2-one.
| Compound Name | 4-[[2-(2-aminoethoxy)ethylamino]methyl]-3H-1,3-thiazol-2-one |
|---|---|
| PubChem CID | 106381718 |
| Molecular Formula | C8H15N3O2S |
| Molecular Weight | 217.29 g/mol |
| Exact Mass | 217.09 |
| IUPAC Name | 4-[[2-(2-aminoethoxy)ethylamino]methyl]-3H-1,3-thiazol-2-one |
| SMILES | NCCOCCNCc1csc(=O)[nH]1 |
| InChI | InChI=1S/C8H15N3O2S/c9-1-3-13-4-2-10-5-7-6-14-8(12)11-7/h6,10H,1-5,9H2,(H,11,12) |
| InChIKey | GWFJSTYPWGFVHZ-UHFFFAOYSA-N |
| XLogP | -0.50 |
| TPSA | 80.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.29 |
| LogP ≤ 5 | -0.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|