C13H25N3OS — CID 114181544
4-[[4-(2-aminoethyl)heptylamino]methyl]-3H-1,3-thiazol-2-one (PubChem CID 114181544) has the molecular formula C13H25N3OS and a molecular weight of 271.43 g/mol. Its IUPAC name is 4-[[4-(2-aminoethyl)heptylamino]methyl]-3H-1,3-thiazol-2-one.
| Compound Name | 4-[[4-(2-aminoethyl)heptylamino]methyl]-3H-1,3-thiazol-2-one |
|---|---|
| PubChem CID | 114181544 |
| Molecular Formula | C13H25N3OS |
| Molecular Weight | 271.43 g/mol |
| Exact Mass | 271.17 |
| IUPAC Name | 4-[[4-(2-aminoethyl)heptylamino]methyl]-3H-1,3-thiazol-2-one |
| SMILES | CCCC(CCN)CCCNCc1csc(=O)[nH]1 |
| InChI | InChI=1S/C13H25N3OS/c1-2-4-11(6-7-14)5-3-8-15-9-12-10-18-13(17)16-12/h10-11,15H,2-9,14H2,1H3,(H,16,17) |
| InChIKey | VIZQWUIYZKHTKL-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 70.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.43 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|