C14H19N3OS — CID 106381770
4-[[3-(4-aminophenyl)butylamino]methyl]-3H-1,3-thiazol-2-one (PubChem CID 106381770) has the molecular formula C14H19N3OS and a molecular weight of 277.39 g/mol. Its IUPAC name is 4-[[3-(4-aminophenyl)butylamino]methyl]-3H-1,3-thiazol-2-one.
| Compound Name | 4-[[3-(4-aminophenyl)butylamino]methyl]-3H-1,3-thiazol-2-one |
|---|---|
| PubChem CID | 106381770 |
| Molecular Formula | C14H19N3OS |
| Molecular Weight | 277.39 g/mol |
| Exact Mass | 277.12 |
| IUPAC Name | 4-[[3-(4-aminophenyl)butylamino]methyl]-3H-1,3-thiazol-2-one |
| SMILES | CC(CCNCc1csc(=O)[nH]1)c1ccc(N)cc1 |
| InChI | InChI=1S/C14H19N3OS/c1-10(11-2-4-12(15)5-3-11)6-7-16-8-13-9-19-14(18)17-13/h2-5,9-10,16H,6-8,15H2,1H3,(H,17,18) |
| InChIKey | RJWCKWJBKVUJRS-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 70.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.39 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|