C10H19N3OS — CID 106381822
4-[[(3-amino-4-methylpentyl)amino]methyl]-3H-1,3-thiazol-2-one (PubChem CID 106381822) has the molecular formula C10H19N3OS and a molecular weight of 229.35 g/mol. Its IUPAC name is 4-[[(3-amino-4-methylpentyl)amino]methyl]-3H-1,3-thiazol-2-one.
| Compound Name | 4-[[(3-amino-4-methylpentyl)amino]methyl]-3H-1,3-thiazol-2-one |
|---|---|
| PubChem CID | 106381822 |
| Molecular Formula | C10H19N3OS |
| Molecular Weight | 229.35 g/mol |
| Exact Mass | 229.12 |
| IUPAC Name | 4-[[(3-amino-4-methylpentyl)amino]methyl]-3H-1,3-thiazol-2-one |
| SMILES | CC(C)C(N)CCNCc1csc(=O)[nH]1 |
| InChI | InChI=1S/C10H19N3OS/c1-7(2)9(11)3-4-12-5-8-6-15-10(14)13-8/h6-7,9,12H,3-5,11H2,1-2H3,(H,13,14) |
| InChIKey | MWDVGUHPUOGTKI-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 70.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.35 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|