C9H15N3OS — CID 106381713
4-[[2-(cyclopropylamino)ethylamino]methyl]-3H-1,3-thiazol-2-one (PubChem CID 106381713) has the molecular formula C9H15N3OS and a molecular weight of 213.31 g/mol. Its IUPAC name is 4-[[2-(cyclopropylamino)ethylamino]methyl]-3H-1,3-thiazol-2-one.
| Compound Name | 4-[[2-(cyclopropylamino)ethylamino]methyl]-3H-1,3-thiazol-2-one |
|---|---|
| PubChem CID | 106381713 |
| Molecular Formula | C9H15N3OS |
| Molecular Weight | 213.31 g/mol |
| Exact Mass | 213.09 |
| IUPAC Name | 4-[[2-(cyclopropylamino)ethylamino]methyl]-3H-1,3-thiazol-2-one |
| SMILES | O=c1[nH]c(CNCCNC2CC2)cs1 |
| InChI | InChI=1S/C9H15N3OS/c13-9-12-8(6-14-9)5-10-3-4-11-7-1-2-7/h6-7,10-11H,1-5H2,(H,12,13) |
| InChIKey | ODDWNFRQJVLLAC-UHFFFAOYSA-N |
| XLogP | 0.28 |
| TPSA | 56.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.31 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|