C8H11F3N2OS — CID 106380757
4-[(4,4,4-trifluorobutylamino)methyl]-3H-1,3-thiazol-2-one (PubChem CID 106380757) has the molecular formula C8H11F3N2OS and a molecular weight of 240.25 g/mol. Its IUPAC name is 4-[(4,4,4-trifluorobutylamino)methyl]-3H-1,3-thiazol-2-one.
| Compound Name | 4-[(4,4,4-trifluorobutylamino)methyl]-3H-1,3-thiazol-2-one |
|---|---|
| PubChem CID | 106380757 |
| Molecular Formula | C8H11F3N2OS |
| Molecular Weight | 240.25 g/mol |
| Exact Mass | 240.05 |
| IUPAC Name | 4-[(4,4,4-trifluorobutylamino)methyl]-3H-1,3-thiazol-2-one |
| SMILES | O=c1[nH]c(CNCCCC(F)(F)F)cs1 |
| InChI | InChI=1S/C8H11F3N2OS/c9-8(10,11)2-1-3-12-4-6-5-15-7(14)13-6/h5,12H,1-4H2,(H,13,14) |
| InChIKey | IGSWNGFQQLFVLR-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 44.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.25 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|