C7H9F3N2OS — CID 106380737
4-[(3,3,3-trifluoropropylamino)methyl]-3H-1,3-thiazol-2-one (PubChem CID 106380737) has the molecular formula C7H9F3N2OS and a molecular weight of 226.22 g/mol. Its IUPAC name is 4-[(3,3,3-trifluoropropylamino)methyl]-3H-1,3-thiazol-2-one.
| Compound Name | 4-[(3,3,3-trifluoropropylamino)methyl]-3H-1,3-thiazol-2-one |
|---|---|
| PubChem CID | 106380737 |
| Molecular Formula | C7H9F3N2OS |
| Molecular Weight | 226.22 g/mol |
| Exact Mass | 226.04 |
| IUPAC Name | 4-[(3,3,3-trifluoropropylamino)methyl]-3H-1,3-thiazol-2-one |
| SMILES | O=c1[nH]c(CNCCC(F)(F)F)cs1 |
| InChI | InChI=1S/C7H9F3N2OS/c8-7(9,10)1-2-11-3-5-4-14-6(13)12-5/h4,11H,1-3H2,(H,12,13) |
| InChIKey | CPLXCGAOOPIPRR-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 44.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.22 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|