C6H9FN2OS — CID 106380671
4-[(2-fluoroethylamino)methyl]-3H-1,3-thiazol-2-one (PubChem CID 106380671) has the molecular formula C6H9FN2OS and a molecular weight of 176.22 g/mol. Its IUPAC name is 4-[(2-fluoroethylamino)methyl]-3H-1,3-thiazol-2-one.
| Compound Name | 4-[(2-fluoroethylamino)methyl]-3H-1,3-thiazol-2-one |
|---|---|
| PubChem CID | 106380671 |
| Molecular Formula | C6H9FN2OS |
| Molecular Weight | 176.22 g/mol |
| Exact Mass | 176.04 |
| IUPAC Name | 4-[(2-fluoroethylamino)methyl]-3H-1,3-thiazol-2-one |
| SMILES | O=c1[nH]c(CNCCF)cs1 |
| InChI | InChI=1S/C6H9FN2OS/c7-1-2-8-3-5-4-11-6(10)9-5/h4,8H,1-3H2,(H,9,10) |
| InChIKey | VJGNUJNLKVWLLV-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 44.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.22 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|