C8H12F3N3OS — CID 106381860
4-[[2-(2,2,2-trifluoroethylamino)ethylamino]methyl]-3H-1,3-thiazol-2-one (PubChem CID 106381860) has the molecular formula C8H12F3N3OS and a molecular weight of 255.26 g/mol. Its IUPAC name is 4-[[2-(2,2,2-trifluoroethylamino)ethylamino]methyl]-3H-1,3-thiazol-2-one.
| Compound Name | 4-[[2-(2,2,2-trifluoroethylamino)ethylamino]methyl]-3H-1,3-thiazol-2-one |
|---|---|
| PubChem CID | 106381860 |
| Molecular Formula | C8H12F3N3OS |
| Molecular Weight | 255.26 g/mol |
| Exact Mass | 255.07 |
| IUPAC Name | 4-[[2-(2,2,2-trifluoroethylamino)ethylamino]methyl]-3H-1,3-thiazol-2-one |
| SMILES | O=c1[nH]c(CNCCNCC(F)(F)F)cs1 |
| InChI | InChI=1S/C8H12F3N3OS/c9-8(10,11)5-13-2-1-12-3-6-4-16-7(15)14-6/h4,12-13H,1-3,5H2,(H,14,15) |
| InChIKey | KVCUMEGHHXWKOI-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 56.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.26 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|