C8H13N3O2S — CID 106381235
(2S)-2-amino-N-[(2-oxo-3H-1,3-thiazol-4-yl)methyl]butanamide (PubChem CID 106381235) has the molecular formula C8H13N3O2S and a molecular weight of 215.28 g/mol. Its IUPAC name is (2S)-2-amino-N-[(2-oxo-3H-1,3-thiazol-4-yl)methyl]butanamide.
| Compound Name | (2S)-2-amino-N-[(2-oxo-3H-1,3-thiazol-4-yl)methyl]butanamide |
|---|---|
| PubChem CID | 106381235 |
| Molecular Formula | C8H13N3O2S |
| Molecular Weight | 215.28 g/mol |
| Exact Mass | 215.07 |
| IUPAC Name | (2S)-2-amino-N-[(2-oxo-3H-1,3-thiazol-4-yl)methyl]butanamide |
| SMILES | CC[C@H](N)C(=O)NCc1csc(=O)[nH]1 |
| InChI | InChI=1S/C8H13N3O2S/c1-2-6(9)7(12)10-3-5-4-14-8(13)11-5/h4,6H,2-3,9H2,1H3,(H,10,12)(H,11,13)/t6-/m0/s1 |
| InChIKey | VSXYIHDVRGXNEY-LURJTMIESA-N |
| XLogP | -0.21 |
| TPSA | 87.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.28 |
| LogP ≤ 5 | -0.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |