C16H20N2O2S — CID 122133474
3-methyl-N-[(2-oxo-3H-1,3-thiazol-4-yl)methyl]-2-phenylpentanamide (PubChem CID 122133474) has the molecular formula C16H20N2O2S and a molecular weight of 304.42 g/mol. Its IUPAC name is 3-methyl-N-[(2-oxo-3H-1,3-thiazol-4-yl)methyl]-2-phenylpentanamide.
| Compound Name | 3-methyl-N-[(2-oxo-3H-1,3-thiazol-4-yl)methyl]-2-phenylpentanamide |
|---|---|
| PubChem CID | 122133474 |
| Molecular Formula | C16H20N2O2S |
| Molecular Weight | 304.42 g/mol |
| Exact Mass | 304.12 |
| IUPAC Name | 3-methyl-N-[(2-oxo-3H-1,3-thiazol-4-yl)methyl]-2-phenylpentanamide |
| SMILES | CCC(C)C(C(=O)NCc1csc(=O)[nH]1)c1ccccc1 |
| InChI | InChI=1S/C16H20N2O2S/c1-3-11(2)14(12-7-5-4-6-8-12)15(19)17-9-13-10-21-16(20)18-13/h4-8,10-11,14H,3,9H2,1-2H3,(H,17,19)(H,18,20) |
| InChIKey | LFTKUYMMRCPFIN-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 61.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.42 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |