C10H17N3O2S — CID 106381106
N-butyl-2-[(2-oxo-3H-1,3-thiazol-4-yl)methylamino]acetamide (PubChem CID 106381106) has the molecular formula C10H17N3O2S and a molecular weight of 243.33 g/mol. Its IUPAC name is N-butyl-2-[(2-oxo-3H-1,3-thiazol-4-yl)methylamino]acetamide.
| Compound Name | N-butyl-2-[(2-oxo-3H-1,3-thiazol-4-yl)methylamino]acetamide |
|---|---|
| PubChem CID | 106381106 |
| Molecular Formula | C10H17N3O2S |
| Molecular Weight | 243.33 g/mol |
| Exact Mass | 243.10 |
| IUPAC Name | N-butyl-2-[(2-oxo-3H-1,3-thiazol-4-yl)methylamino]acetamide |
| SMILES | CCCCNC(=O)CNCc1csc(=O)[nH]1 |
| InChI | InChI=1S/C10H17N3O2S/c1-2-3-4-12-9(14)6-11-5-8-7-16-10(15)13-8/h7,11H,2-6H2,1H3,(H,12,14)(H,13,15) |
| InChIKey | ZPISGNVJOBLORM-UHFFFAOYSA-N |
| XLogP | 0.44 |
| TPSA | 73.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.33 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|