C11H19N3O2 — CID 106372322
N-butyl-2-[(5-methyl-1,3-oxazol-2-yl)methylamino]acetamide (PubChem CID 106372322) has the molecular formula C11H19N3O2 and a molecular weight of 225.29 g/mol. Its IUPAC name is N-butyl-2-[(5-methyl-1,3-oxazol-2-yl)methylamino]acetamide.
| Compound Name | N-butyl-2-[(5-methyl-1,3-oxazol-2-yl)methylamino]acetamide |
|---|---|
| PubChem CID | 106372322 |
| Molecular Formula | C11H19N3O2 |
| Molecular Weight | 225.29 g/mol |
| Exact Mass | 225.15 |
| IUPAC Name | N-butyl-2-[(5-methyl-1,3-oxazol-2-yl)methylamino]acetamide |
| SMILES | CCCCNC(=O)CNCc1ncc(C)o1 |
| InChI | InChI=1S/C11H19N3O2/c1-3-4-5-13-10(15)7-12-8-11-14-6-9(2)16-11/h6,12H,3-5,7-8H2,1-2H3,(H,13,15) |
| InChIKey | WNSKIDATZVXTNE-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 67.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.29 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|