C8H14N2O2 — CID 106371738
3-[(5-methyl-1,3-oxazol-2-yl)methylamino]propan-1-ol (PubChem CID 106371738) has the molecular formula C8H14N2O2 and a molecular weight of 170.21 g/mol. Its IUPAC name is 3-[(5-methyl-1,3-oxazol-2-yl)methylamino]propan-1-ol.
| Compound Name | 3-[(5-methyl-1,3-oxazol-2-yl)methylamino]propan-1-ol |
|---|---|
| PubChem CID | 106371738 |
| Molecular Formula | C8H14N2O2 |
| Molecular Weight | 170.21 g/mol |
| Exact Mass | 170.11 |
| IUPAC Name | 3-[(5-methyl-1,3-oxazol-2-yl)methylamino]propan-1-ol |
| SMILES | Cc1cnc(CNCCCO)o1 |
| InChI | InChI=1S/C8H14N2O2/c1-7-5-10-8(12-7)6-9-3-2-4-11/h5,9,11H,2-4,6H2,1H3 |
| InChIKey | OKQMHJTZBOAVHJ-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 58.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.21 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|