C7H13N3O2 — CID 103604755
3-[(5-methyl-1,3,4-oxadiazol-2-yl)methylamino]propan-1-ol (PubChem CID 103604755) has the molecular formula C7H13N3O2 and a molecular weight of 171.20 g/mol. Its IUPAC name is 3-[(5-methyl-1,3,4-oxadiazol-2-yl)methylamino]propan-1-ol.
| Compound Name | 3-[(5-methyl-1,3,4-oxadiazol-2-yl)methylamino]propan-1-ol |
|---|---|
| PubChem CID | 103604755 |
| Molecular Formula | C7H13N3O2 |
| Molecular Weight | 171.20 g/mol |
| Exact Mass | 171.10 |
| IUPAC Name | 3-[(5-methyl-1,3,4-oxadiazol-2-yl)methylamino]propan-1-ol |
| SMILES | Cc1nnc(CNCCCO)o1 |
| InChI | InChI=1S/C7H13N3O2/c1-6-9-10-7(12-6)5-8-3-2-4-11/h8,11H,2-5H2,1H3 |
| InChIKey | JKSHWOGVMBLYNY-UHFFFAOYSA-N |
| XLogP | -0.15 |
| TPSA | 71.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.20 |
| LogP ≤ 5 | -0.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|