C9H17N3OS — CID 107914883
N-[(5-methyl-1,3,4-oxadiazol-2-yl)methyl]-3-methylsulfanylbutan-1-amine (PubChem CID 107914883) has the molecular formula C9H17N3OS and a molecular weight of 215.32 g/mol. Its IUPAC name is N-[(5-methyl-1,3,4-oxadiazol-2-yl)methyl]-3-methylsulfanylbutan-1-amine.
| Compound Name | N-[(5-methyl-1,3,4-oxadiazol-2-yl)methyl]-3-methylsulfanylbutan-1-amine |
|---|---|
| PubChem CID | 107914883 |
| Molecular Formula | C9H17N3OS |
| Molecular Weight | 215.32 g/mol |
| Exact Mass | 215.11 |
| IUPAC Name | N-[(5-methyl-1,3,4-oxadiazol-2-yl)methyl]-3-methylsulfanylbutan-1-amine |
| SMILES | CSC(C)CCNCc1nnc(C)o1 |
| InChI | InChI=1S/C9H17N3OS/c1-7(14-3)4-5-10-6-9-12-11-8(2)13-9/h7,10H,4-6H2,1-3H3 |
| InChIKey | UJGHTJCWHJHSML-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 50.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.32 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|