C9H16N4O2 — CID 106237182
5-[(5-methyl-1,3,4-oxadiazol-2-yl)methylamino]pentanamide (PubChem CID 106237182) has the molecular formula C9H16N4O2 and a molecular weight of 212.25 g/mol. Its IUPAC name is 5-[(5-methyl-1,3,4-oxadiazol-2-yl)methylamino]pentanamide.
| Compound Name | 5-[(5-methyl-1,3,4-oxadiazol-2-yl)methylamino]pentanamide |
|---|---|
| PubChem CID | 106237182 |
| Molecular Formula | C9H16N4O2 |
| Molecular Weight | 212.25 g/mol |
| Exact Mass | 212.13 |
| IUPAC Name | 5-[(5-methyl-1,3,4-oxadiazol-2-yl)methylamino]pentanamide |
| SMILES | Cc1nnc(CNCCCCC(N)=O)o1 |
| InChI | InChI=1S/C9H16N4O2/c1-7-12-13-9(15-7)6-11-5-3-2-4-8(10)14/h11H,2-6H2,1H3,(H2,10,14) |
| InChIKey | VJPDNXFNFDOJEX-UHFFFAOYSA-N |
| XLogP | 0.12 |
| TPSA | 94.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.25 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|