C8H12N2O3 — CID 60911040
5-(5-methyl-1,3,4-oxadiazol-2-yl)pentanoic acid (PubChem CID 60911040) has the molecular formula C8H12N2O3 and a molecular weight of 184.19 g/mol. Its IUPAC name is 5-(5-methyl-1,3,4-oxadiazol-2-yl)pentanoic acid.
| Compound Name | 5-(5-methyl-1,3,4-oxadiazol-2-yl)pentanoic acid |
|---|---|
| PubChem CID | 60911040 |
| Molecular Formula | C8H12N2O3 |
| Molecular Weight | 184.19 g/mol |
| Exact Mass | 184.08 |
| IUPAC Name | 5-(5-methyl-1,3,4-oxadiazol-2-yl)pentanoic acid |
| SMILES | Cc1nnc(CCCCC(=O)O)o1 |
| InChI | InChI=1S/C8H12N2O3/c1-6-9-10-7(13-6)4-2-3-5-8(11)12/h2-5H2,1H3,(H,11,12) |
| InChIKey | KIUSKEBRJRTLBS-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 76.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.19 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|