4-(5-amino-1,3,4-oxadiazol-2-yl)butanoic acid

C6H9N3O3 — CID 82468092

IUPAC4-(5-amino-1,3,4-oxadiazol-2-yl)butanoic acid
SMILESNc1nnc(CCCC(=O)O)o1
InChIInChI=1S/C6H9N3O3/c7-6-9-8-4(12-6)2-1-3-5(10)11/h1-3H2,(H2,7,9)(H,10,11)
InChIKeyWLYOPSGXRMSPTI-UHFFFAOYSA-N
MW171.16 g/mol
LogP0.06
Rot. Bonds4

About 4-(5-amino-1,3,4-oxadiazol-2-yl)butanoic acid

4-(5-amino-1,3,4-oxadiazol-2-yl)butanoic acid (PubChem CID 82468092) has the molecular formula C6H9N3O3 and a molecular weight of 171.16 g/mol. Its IUPAC name is 4-(5-amino-1,3,4-oxadiazol-2-yl)butanoic acid.

Molecular Properties

Compound Name4-(5-amino-1,3,4-oxadiazol-2-yl)butanoic acid
PubChem CID82468092
Molecular FormulaC6H9N3O3
Molecular Weight171.16 g/mol
Exact Mass171.06
IUPAC Name4-(5-amino-1,3,4-oxadiazol-2-yl)butanoic acid
SMILESNc1nnc(CCCC(=O)O)o1
InChIInChI=1S/C6H9N3O3/c7-6-9-8-4(12-6)2-1-3-5(10)11/h1-3H2,(H2,7,9)(H,10,11)
InChIKeyWLYOPSGXRMSPTI-UHFFFAOYSA-N
XLogP0.06
TPSA102.24 Ų
H-Bond Donors2
H-Bond Acceptors5
Rotatable Bonds4
Heavy Atoms12
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500171.16
LogP ≤ 50.06
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 105

Analyze 4-(5-amino-1,3,4-oxadiazol-2-yl)butanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-(5-amino-1,3,4-oxadiazol-2-yl)butanoic acid?
The IUPAC name of 4-(5-amino-1,3,4-oxadiazol-2-yl)butanoic acid (CID 82468092) is 4-(5-amino-1,3,4-oxadiazol-2-yl)butanoic acid.
What is the SMILES notation for 4-(5-amino-1,3,4-oxadiazol-2-yl)butanoic acid?
The canonical SMILES for 4-(5-amino-1,3,4-oxadiazol-2-yl)butanoic acid is Nc1nnc(CCCC(=O)O)o1.
What is the InChIKey of 4-(5-amino-1,3,4-oxadiazol-2-yl)butanoic acid?
The InChIKey is WLYOPSGXRMSPTI-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H9N3O3/c7-6-9-8-4(12-6)2-1-3-5(10)11/h1-3H2,(H2,7,9)(H,10,11).
What are the key properties of 4-(5-amino-1,3,4-oxadiazol-2-yl)butanoic acid?
4-(5-amino-1,3,4-oxadiazol-2-yl)butanoic acid has a molecular weight of 171.16 g/mol, XLogP of 0.06, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(5-amino-1,3,4-oxadiazol-2-yl)butanoic acid is sourced from PubChem (CID 82468092), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).