C6H8N2O3 — CID 39235436
4-(1,3,4-oxadiazol-2-yl)butanoic acid (PubChem CID 39235436) has the molecular formula C6H8N2O3 and a molecular weight of 156.14 g/mol. Its IUPAC name is 4-(1,3,4-oxadiazol-2-yl)butanoic acid.
| Compound Name | 4-(1,3,4-oxadiazol-2-yl)butanoic acid |
|---|---|
| PubChem CID | 39235436 |
| Molecular Formula | C6H8N2O3 |
| Molecular Weight | 156.14 g/mol |
| Exact Mass | 156.05 |
| IUPAC Name | 4-(1,3,4-oxadiazol-2-yl)butanoic acid |
| SMILES | O=C(O)CCCc1nnco1 |
| InChI | InChI=1S/C6H8N2O3/c9-6(10)3-1-2-5-8-7-4-11-5/h4H,1-3H2,(H,9,10) |
| InChIKey | ZCSWOTPSQNPZSP-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 76.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 156.14 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |