4-(1,3,4-oxadiazol-2-yl)butanoic acid

C6H8N2O3 — CID 39235436

IUPAC4-(1,3,4-oxadiazol-2-yl)butanoic acid
SMILESO=C(O)CCCc1nnco1
InChIInChI=1S/C6H8N2O3/c9-6(10)3-1-2-5-8-7-4-11-5/h4H,1-3H2,(H,9,10)
InChIKeyZCSWOTPSQNPZSP-UHFFFAOYSA-N
MW156.14 g/mol
LogP0.48
Rot. Bonds4

About 4-(1,3,4-oxadiazol-2-yl)butanoic acid

4-(1,3,4-oxadiazol-2-yl)butanoic acid (PubChem CID 39235436) has the molecular formula C6H8N2O3 and a molecular weight of 156.14 g/mol. Its IUPAC name is 4-(1,3,4-oxadiazol-2-yl)butanoic acid.

Molecular Properties

Compound Name4-(1,3,4-oxadiazol-2-yl)butanoic acid
PubChem CID39235436
Molecular FormulaC6H8N2O3
Molecular Weight156.14 g/mol
Exact Mass156.05
IUPAC Name4-(1,3,4-oxadiazol-2-yl)butanoic acid
SMILESO=C(O)CCCc1nnco1
InChIInChI=1S/C6H8N2O3/c9-6(10)3-1-2-5-8-7-4-11-5/h4H,1-3H2,(H,9,10)
InChIKeyZCSWOTPSQNPZSP-UHFFFAOYSA-N
XLogP0.48
TPSA76.22 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds4
Heavy Atoms11
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500156.14
LogP ≤ 50.48
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze 4-(1,3,4-oxadiazol-2-yl)butanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-(1,3,4-oxadiazol-2-yl)butanoic acid?
The IUPAC name of 4-(1,3,4-oxadiazol-2-yl)butanoic acid (CID 39235436) is 4-(1,3,4-oxadiazol-2-yl)butanoic acid.
What is the SMILES notation for 4-(1,3,4-oxadiazol-2-yl)butanoic acid?
The canonical SMILES for 4-(1,3,4-oxadiazol-2-yl)butanoic acid is O=C(O)CCCc1nnco1.
What is the InChIKey of 4-(1,3,4-oxadiazol-2-yl)butanoic acid?
The InChIKey is ZCSWOTPSQNPZSP-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8N2O3/c9-6(10)3-1-2-5-8-7-4-11-5/h4H,1-3H2,(H,9,10).
What are the key properties of 4-(1,3,4-oxadiazol-2-yl)butanoic acid?
4-(1,3,4-oxadiazol-2-yl)butanoic acid has a molecular weight of 156.14 g/mol, XLogP of 0.48, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(1,3,4-oxadiazol-2-yl)butanoic acid is sourced from PubChem (CID 39235436), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).