5-(1,2-oxazol-3-yl)pentanoic acid

C8H11NO3 — CID 174347954

IUPAC5-(1,2-oxazol-3-yl)pentanoic acid
SMILESO=C(O)CCCCc1ccon1
InChIInChI=1S/C8H11NO3/c10-8(11)4-2-1-3-7-5-6-12-9-7/h5-6H,1-4H2,(H,10,11)
InChIKeyJBBUYKGYWDGQGF-UHFFFAOYSA-N
MW169.18 g/mol
LogP1.47
Rot. Bonds5

About 5-(1,2-oxazol-3-yl)pentanoic acid

5-(1,2-oxazol-3-yl)pentanoic acid (PubChem CID 174347954) has the molecular formula C8H11NO3 and a molecular weight of 169.18 g/mol. Its IUPAC name is 5-(1,2-oxazol-3-yl)pentanoic acid.

Molecular Properties

Compound Name5-(1,2-oxazol-3-yl)pentanoic acid
PubChem CID174347954
Molecular FormulaC8H11NO3
Molecular Weight169.18 g/mol
Exact Mass169.07
IUPAC Name5-(1,2-oxazol-3-yl)pentanoic acid
SMILESO=C(O)CCCCc1ccon1
InChIInChI=1S/C8H11NO3/c10-8(11)4-2-1-3-7-5-6-12-9-7/h5-6H,1-4H2,(H,10,11)
InChIKeyJBBUYKGYWDGQGF-UHFFFAOYSA-N
XLogP1.47
TPSA63.33 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds5
Heavy Atoms12
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500169.18
LogP ≤ 51.47
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}

Analyze 5-(1,2-oxazol-3-yl)pentanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 5-(1,2-oxazol-3-yl)pentanoic acid?
The IUPAC name of 5-(1,2-oxazol-3-yl)pentanoic acid (CID 174347954) is 5-(1,2-oxazol-3-yl)pentanoic acid.
What is the SMILES notation for 5-(1,2-oxazol-3-yl)pentanoic acid?
The canonical SMILES for 5-(1,2-oxazol-3-yl)pentanoic acid is O=C(O)CCCCc1ccon1.
What is the InChIKey of 5-(1,2-oxazol-3-yl)pentanoic acid?
The InChIKey is JBBUYKGYWDGQGF-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11NO3/c10-8(11)4-2-1-3-7-5-6-12-9-7/h5-6H,1-4H2,(H,10,11).
What are the key properties of 5-(1,2-oxazol-3-yl)pentanoic acid?
5-(1,2-oxazol-3-yl)pentanoic acid has a molecular weight of 169.18 g/mol, XLogP of 1.47, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(1,2-oxazol-3-yl)pentanoic acid is sourced from PubChem (CID 174347954), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).