C8H11NO3 — CID 174347954
5-(1,2-oxazol-3-yl)pentanoic acid (PubChem CID 174347954) has the molecular formula C8H11NO3 and a molecular weight of 169.18 g/mol. Its IUPAC name is 5-(1,2-oxazol-3-yl)pentanoic acid.
| Compound Name | 5-(1,2-oxazol-3-yl)pentanoic acid |
|---|---|
| PubChem CID | 174347954 |
| Molecular Formula | C8H11NO3 |
| Molecular Weight | 169.18 g/mol |
| Exact Mass | 169.07 |
| IUPAC Name | 5-(1,2-oxazol-3-yl)pentanoic acid |
| SMILES | O=C(O)CCCCc1ccon1 |
| InChI | InChI=1S/C8H11NO3/c10-8(11)4-2-1-3-7-5-6-12-9-7/h5-6H,1-4H2,(H,10,11) |
| InChIKey | JBBUYKGYWDGQGF-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 63.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.18 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|