5-pyrazin-2-ylpentanoic acid

C9H12N2O2 — CID 22934386

IUPAC5-pyrazin-2-ylpentanoic acid
SMILESO=C(O)CCCCc1cnccn1
InChIInChI=1S/C9H12N2O2/c12-9(13)4-2-1-3-8-7-10-5-6-11-8/h5-7H,1-4H2,(H,12,13)
InChIKeyUTKDOCRAPYZZEW-UHFFFAOYSA-N
MW180.21 g/mol
LogP1.27
Rot. Bonds5

About 5-pyrazin-2-ylpentanoic acid

5-pyrazin-2-ylpentanoic acid (PubChem CID 22934386) has the molecular formula C9H12N2O2 and a molecular weight of 180.21 g/mol. Its IUPAC name is 5-pyrazin-2-ylpentanoic acid.

Molecular Properties

Compound Name5-pyrazin-2-ylpentanoic acid
PubChem CID22934386
Molecular FormulaC9H12N2O2
Molecular Weight180.21 g/mol
Exact Mass180.09
IUPAC Name5-pyrazin-2-ylpentanoic acid
SMILESO=C(O)CCCCc1cnccn1
InChIInChI=1S/C9H12N2O2/c12-9(13)4-2-1-3-8-7-10-5-6-11-8/h5-7H,1-4H2,(H,12,13)
InChIKeyUTKDOCRAPYZZEW-UHFFFAOYSA-N
XLogP1.27
TPSA63.08 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds5
Heavy Atoms13
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500180.21
LogP ≤ 51.27
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}

Analyze 5-pyrazin-2-ylpentanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 5-pyrazin-2-ylpentanoic acid?
The IUPAC name of 5-pyrazin-2-ylpentanoic acid (CID 22934386) is 5-pyrazin-2-ylpentanoic acid.
What is the SMILES notation for 5-pyrazin-2-ylpentanoic acid?
The canonical SMILES for 5-pyrazin-2-ylpentanoic acid is O=C(O)CCCCc1cnccn1.
What is the InChIKey of 5-pyrazin-2-ylpentanoic acid?
The InChIKey is UTKDOCRAPYZZEW-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12N2O2/c12-9(13)4-2-1-3-8-7-10-5-6-11-8/h5-7H,1-4H2,(H,12,13).
What are the key properties of 5-pyrazin-2-ylpentanoic acid?
5-pyrazin-2-ylpentanoic acid has a molecular weight of 180.21 g/mol, XLogP of 1.27, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-pyrazin-2-ylpentanoic acid is sourced from PubChem (CID 22934386), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).