About 5-pyrazin-2-ylpentanoic acid
5-pyrazin-2-ylpentanoic acid (PubChem CID 22934386) has the molecular formula C9H12N2O2
and a molecular weight of 180.21 g/mol. Its IUPAC name is 5-pyrazin-2-ylpentanoic acid.
Molecular Properties
| Compound Name | 5-pyrazin-2-ylpentanoic acid |
| PubChem CID | 22934386 |
| Molecular Formula | C9H12N2O2 |
| Molecular Weight | 180.21 g/mol |
| Exact Mass | 180.09 |
| IUPAC Name | 5-pyrazin-2-ylpentanoic acid |
| SMILES | O=C(O)CCCCc1cnccn1 |
| InChI | InChI=1S/C9H12N2O2/c12-9(13)4-2-1-3-8-7-10-5-6-11-8/h5-7H,1-4H2,(H,12,13) |
| InChIKey | UTKDOCRAPYZZEW-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 63.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.21 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 5-pyrazin-2-ylpentanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-pyrazin-2-ylpentanoic acid?
The IUPAC name of 5-pyrazin-2-ylpentanoic acid (CID 22934386) is 5-pyrazin-2-ylpentanoic acid.
What is the SMILES notation for 5-pyrazin-2-ylpentanoic acid?
The canonical SMILES for 5-pyrazin-2-ylpentanoic acid is O=C(O)CCCCc1cnccn1.
What is the InChIKey of 5-pyrazin-2-ylpentanoic acid?
The InChIKey is UTKDOCRAPYZZEW-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12N2O2/c12-9(13)4-2-1-3-8-7-10-5-6-11-8/h5-7H,1-4H2,(H,12,13).
What are the key properties of 5-pyrazin-2-ylpentanoic acid?
5-pyrazin-2-ylpentanoic acid has a molecular weight of 180.21 g/mol, XLogP of 1.27, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-pyrazin-2-ylpentanoic acid is sourced from PubChem (CID 22934386), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).