About 8-pyrazin-2-yloctanoic acid
8-pyrazin-2-yloctanoic acid (PubChem CID 67107978) has the molecular formula C12H18N2O2
and a molecular weight of 222.29 g/mol. Its IUPAC name is 8-pyrazin-2-yloctanoic acid.
Molecular Properties
| Compound Name | 8-pyrazin-2-yloctanoic acid |
| PubChem CID | 67107978 |
| Molecular Formula | C12H18N2O2 |
| Molecular Weight | 222.29 g/mol |
| Exact Mass | 222.14 |
| IUPAC Name | 8-pyrazin-2-yloctanoic acid |
| SMILES | O=C(O)CCCCCCCc1cnccn1 |
| InChI | InChI=1S/C12H18N2O2/c15-12(16)7-5-3-1-2-4-6-11-10-13-8-9-14-11/h8-10H,1-7H2,(H,15,16) |
| InChIKey | KWLDWWMVFCQTDO-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 63.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.29 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 8-pyrazin-2-yloctanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-pyrazin-2-yloctanoic acid?
The IUPAC name of 8-pyrazin-2-yloctanoic acid (CID 67107978) is 8-pyrazin-2-yloctanoic acid.
What is the SMILES notation for 8-pyrazin-2-yloctanoic acid?
The canonical SMILES for 8-pyrazin-2-yloctanoic acid is O=C(O)CCCCCCCc1cnccn1.
What is the InChIKey of 8-pyrazin-2-yloctanoic acid?
The InChIKey is KWLDWWMVFCQTDO-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18N2O2/c15-12(16)7-5-3-1-2-4-6-11-10-13-8-9-14-11/h8-10H,1-7H2,(H,15,16).
What are the key properties of 8-pyrazin-2-yloctanoic acid?
8-pyrazin-2-yloctanoic acid has a molecular weight of 222.29 g/mol, XLogP of 2.44, 8 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 8-pyrazin-2-yloctanoic acid is sourced from PubChem (CID 67107978), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).