8-pyrazin-2-yloctanoic acid

C12H18N2O2 — CID 67107978

IUPAC8-pyrazin-2-yloctanoic acid
SMILESO=C(O)CCCCCCCc1cnccn1
InChIInChI=1S/C12H18N2O2/c15-12(16)7-5-3-1-2-4-6-11-10-13-8-9-14-11/h8-10H,1-7H2,(H,15,16)
InChIKeyKWLDWWMVFCQTDO-UHFFFAOYSA-N
MW222.29 g/mol
LogP2.44
Rot. Bonds8

About 8-pyrazin-2-yloctanoic acid

8-pyrazin-2-yloctanoic acid (PubChem CID 67107978) has the molecular formula C12H18N2O2 and a molecular weight of 222.29 g/mol. Its IUPAC name is 8-pyrazin-2-yloctanoic acid.

Molecular Properties

Compound Name8-pyrazin-2-yloctanoic acid
PubChem CID67107978
Molecular FormulaC12H18N2O2
Molecular Weight222.29 g/mol
Exact Mass222.14
IUPAC Name8-pyrazin-2-yloctanoic acid
SMILESO=C(O)CCCCCCCc1cnccn1
InChIInChI=1S/C12H18N2O2/c15-12(16)7-5-3-1-2-4-6-11-10-13-8-9-14-11/h8-10H,1-7H2,(H,15,16)
InChIKeyKWLDWWMVFCQTDO-UHFFFAOYSA-N
XLogP2.44
TPSA63.08 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds8
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500222.29
LogP ≤ 52.44
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}

Analyze 8-pyrazin-2-yloctanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 8-pyrazin-2-yloctanoic acid?
The IUPAC name of 8-pyrazin-2-yloctanoic acid (CID 67107978) is 8-pyrazin-2-yloctanoic acid.
What is the SMILES notation for 8-pyrazin-2-yloctanoic acid?
The canonical SMILES for 8-pyrazin-2-yloctanoic acid is O=C(O)CCCCCCCc1cnccn1.
What is the InChIKey of 8-pyrazin-2-yloctanoic acid?
The InChIKey is KWLDWWMVFCQTDO-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18N2O2/c15-12(16)7-5-3-1-2-4-6-11-10-13-8-9-14-11/h8-10H,1-7H2,(H,15,16).
What are the key properties of 8-pyrazin-2-yloctanoic acid?
8-pyrazin-2-yloctanoic acid has a molecular weight of 222.29 g/mol, XLogP of 2.44, 8 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 8-pyrazin-2-yloctanoic acid is sourced from PubChem (CID 67107978), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).