C12H10N4O2 — CID 57316761
1,4-di(pyrazin-2-yl)butane-2,3-dione (PubChem CID 57316761) has the molecular formula C12H10N4O2 and a molecular weight of 242.24 g/mol. Its IUPAC name is 1,4-di(pyrazin-2-yl)butane-2,3-dione.
| Compound Name | 1,4-di(pyrazin-2-yl)butane-2,3-dione |
|---|---|
| PubChem CID | 57316761 |
| Molecular Formula | C12H10N4O2 |
| Molecular Weight | 242.24 g/mol |
| Exact Mass | 242.08 |
| IUPAC Name | 1,4-di(pyrazin-2-yl)butane-2,3-dione |
| SMILES | O=C(Cc1cnccn1)C(=O)Cc1cnccn1 |
| InChI | InChI=1S/C12H10N4O2/c17-11(5-9-7-13-1-3-15-9)12(18)6-10-8-14-2-4-16-10/h1-4,7-8H,5-6H2 |
| InChIKey | FWJJLCIGRSSIDU-UHFFFAOYSA-N |
| XLogP | 0.19 |
| TPSA | 85.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.24 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|