C12H8Cl2N2O2 — CID 174964447
(2,3-dichlorophenyl) 2-pyrazin-2-ylacetate (PubChem CID 174964447) has the molecular formula C12H8Cl2N2O2 and a molecular weight of 283.11 g/mol. Its IUPAC name is (2,3-dichlorophenyl) 2-pyrazin-2-ylacetate.
| Compound Name | (2,3-dichlorophenyl) 2-pyrazin-2-ylacetate |
|---|---|
| PubChem CID | 174964447 |
| Molecular Formula | C12H8Cl2N2O2 |
| Molecular Weight | 283.11 g/mol |
| Exact Mass | 282.00 |
| IUPAC Name | (2,3-dichlorophenyl) 2-pyrazin-2-ylacetate |
| SMILES | O=C(Cc1cnccn1)Oc1cccc(Cl)c1Cl |
| InChI | InChI=1S/C12H8Cl2N2O2/c13-9-2-1-3-10(12(9)14)18-11(17)6-8-7-15-4-5-16-8/h1-5,7H,6H2 |
| InChIKey | INZDMTQBCIZSFM-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 52.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.11 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|