C16H12Cl2O4 — CID 3580698
(2,3-dichlorophenyl) 2-(2,3-dihydro-1,4-benzodioxin-6-yl)acetate (PubChem CID 3580698) has the molecular formula C16H12Cl2O4 and a molecular weight of 339.17 g/mol. Its IUPAC name is (2,3-dichlorophenyl) 2-(2,3-dihydro-1,4-benzodioxin-6-yl)acetate.
| Compound Name | (2,3-dichlorophenyl) 2-(2,3-dihydro-1,4-benzodioxin-6-yl)acetate |
|---|---|
| PubChem CID | 3580698 |
| Molecular Formula | C16H12Cl2O4 |
| Molecular Weight | 339.17 g/mol |
| Exact Mass | 338.01 |
| IUPAC Name | (2,3-dichlorophenyl) 2-(2,3-dihydro-1,4-benzodioxin-6-yl)acetate |
| SMILES | O=C(Cc1ccc2c(c1)OCCO2)Oc1cccc(Cl)c1Cl |
| InChI | InChI=1S/C16H12Cl2O4/c17-11-2-1-3-13(16(11)18)22-15(19)9-10-4-5-12-14(8-10)21-7-6-20-12/h1-5,8H,6-7,9H2 |
| InChIKey | IPBLJIAZRGTCEL-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.17 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|