C23H17FO5 — CID 7931073
[4-(4-fluorobenzoyl)phenyl] 2-(2,3-dihydro-1,4-benzodioxin-6-yl)acetate (PubChem CID 7931073) has the molecular formula C23H17FO5 and a molecular weight of 392.38 g/mol. Its IUPAC name is [4-(4-fluorobenzoyl)phenyl] 2-(2,3-dihydro-1,4-benzodioxin-6-yl)acetate.
| Compound Name | [4-(4-fluorobenzoyl)phenyl] 2-(2,3-dihydro-1,4-benzodioxin-6-yl)acetate |
|---|---|
| PubChem CID | 7931073 |
| Molecular Formula | C23H17FO5 |
| Molecular Weight | 392.38 g/mol |
| Exact Mass | 392.11 |
| IUPAC Name | [4-(4-fluorobenzoyl)phenyl] 2-(2,3-dihydro-1,4-benzodioxin-6-yl)acetate |
| SMILES | O=C(Cc1ccc2c(c1)OCCO2)Oc1ccc(C(=O)c2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C23H17FO5/c24-18-6-2-16(3-7-18)23(26)17-4-8-19(9-5-17)29-22(25)14-15-1-10-20-21(13-15)28-12-11-27-20/h1-10,13H,11-12,14H2 |
| InChIKey | HUJBRIDBDXDDBY-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.38 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|