C18H17ClO4 — CID 86944057
(2-chlorophenyl) 3-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)propanoate (PubChem CID 86944057) has the molecular formula C18H17ClO4 and a molecular weight of 332.78 g/mol. Its IUPAC name is (2-chlorophenyl) 3-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)propanoate.
| Compound Name | (2-chlorophenyl) 3-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)propanoate |
|---|---|
| PubChem CID | 86944057 |
| Molecular Formula | C18H17ClO4 |
| Molecular Weight | 332.78 g/mol |
| Exact Mass | 332.08 |
| IUPAC Name | (2-chlorophenyl) 3-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)propanoate |
| SMILES | O=C(CCc1ccc2c(c1)OCCCO2)Oc1ccccc1Cl |
| InChI | InChI=1S/C18H17ClO4/c19-14-4-1-2-5-15(14)23-18(20)9-7-13-6-8-16-17(12-13)22-11-3-10-21-16/h1-2,4-6,8,12H,3,7,9-11H2 |
| InChIKey | UZKNUOVNJDDCTK-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.78 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|