C9H14N2O2 — CID 90927084
6-(1,2-oxazol-3-yl)hexanamide (PubChem CID 90927084) has the molecular formula C9H14N2O2 and a molecular weight of 182.22 g/mol. Its IUPAC name is 6-(1,2-oxazol-3-yl)hexanamide.
| Compound Name | 6-(1,2-oxazol-3-yl)hexanamide |
|---|---|
| PubChem CID | 90927084 |
| Molecular Formula | C9H14N2O2 |
| Molecular Weight | 182.22 g/mol |
| Exact Mass | 182.11 |
| IUPAC Name | 6-(1,2-oxazol-3-yl)hexanamide |
| SMILES | NC(=O)CCCCCc1ccon1 |
| InChI | InChI=1S/C9H14N2O2/c10-9(12)5-3-1-2-4-8-6-7-13-11-8/h6-7H,1-5H2,(H2,10,12) |
| InChIKey | XRDDTTYSCLPYCU-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 69.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.22 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|