About 4-[5-(difluoromethyl)-1,3,4-oxadiazol-2-yl]butanoic acid
4-[5-(difluoromethyl)-1,3,4-oxadiazol-2-yl]butanoic acid (PubChem CID 60912450) has the molecular formula C7H8F2N2O3
and a molecular weight of 206.15 g/mol. Its IUPAC name is 4-[5-(difluoromethyl)-1,3,4-oxadiazol-2-yl]butanoic acid.
Analyze 4-[5-(difluoromethyl)-1,3,4-oxadiazol-2-yl]butanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[5-(difluoromethyl)-1,3,4-oxadiazol-2-yl]butanoic acid?
The IUPAC name of 4-[5-(difluoromethyl)-1,3,4-oxadiazol-2-yl]butanoic acid (CID 60912450) is 4-[5-(difluoromethyl)-1,3,4-oxadiazol-2-yl]butanoic acid.
What is the SMILES notation for 4-[5-(difluoromethyl)-1,3,4-oxadiazol-2-yl]butanoic acid?
The canonical SMILES for 4-[5-(difluoromethyl)-1,3,4-oxadiazol-2-yl]butanoic acid is O=C(O)CCCc1nnc(C(F)F)o1.
What is the InChIKey of 4-[5-(difluoromethyl)-1,3,4-oxadiazol-2-yl]butanoic acid?
The InChIKey is RBPKZOQODWBTKD-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8F2N2O3/c8-6(9)7-11-10-4(14-7)2-1-3-5(12)13/h6H,1-3H2,(H,12,13).
What are the key properties of 4-[5-(difluoromethyl)-1,3,4-oxadiazol-2-yl]butanoic acid?
4-[5-(difluoromethyl)-1,3,4-oxadiazol-2-yl]butanoic acid has a molecular weight of 206.15 g/mol, XLogP of 1.41, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[5-(difluoromethyl)-1,3,4-oxadiazol-2-yl]butanoic acid is sourced from PubChem (CID 60912450), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).