About ethane;7-(5-methyl-1,3,4-oxadiazol-2-yl)heptan-2-one
ethane;7-(5-methyl-1,3,4-oxadiazol-2-yl)heptan-2-one (PubChem CID 167517152) has the molecular formula C12H22N2O2
and a molecular weight of 226.32 g/mol. Its IUPAC name is ethane;7-(5-methyl-1,3,4-oxadiazol-2-yl)heptan-2-one.
Molecular Properties
| Compound Name | ethane;7-(5-methyl-1,3,4-oxadiazol-2-yl)heptan-2-one |
| PubChem CID | 167517152 |
| Molecular Formula | C12H22N2O2 |
| Molecular Weight | 226.32 g/mol |
| Exact Mass | 226.17 |
| IUPAC Name | ethane;7-(5-methyl-1,3,4-oxadiazol-2-yl)heptan-2-one |
| SMILES | CC.CC(=O)CCCCCc1nnc(C)o1 |
| InChI | InChI=1S/C10H16N2O2.C2H6/c1-8(13)6-4-3-5-7-10-12-11-9(2)14-10;1-2/h3-7H2,1-2H3;1-2H3 |
| InChIKey | NAMTUZUNASLYSS-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 55.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.32 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze ethane;7-(5-methyl-1,3,4-oxadiazol-2-yl)heptan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;7-(5-methyl-1,3,4-oxadiazol-2-yl)heptan-2-one?
The IUPAC name of ethane;7-(5-methyl-1,3,4-oxadiazol-2-yl)heptan-2-one (CID 167517152) is ethane;7-(5-methyl-1,3,4-oxadiazol-2-yl)heptan-2-one.
What is the SMILES notation for ethane;7-(5-methyl-1,3,4-oxadiazol-2-yl)heptan-2-one?
The canonical SMILES for ethane;7-(5-methyl-1,3,4-oxadiazol-2-yl)heptan-2-one is CC.CC(=O)CCCCCc1nnc(C)o1.
What is the InChIKey of ethane;7-(5-methyl-1,3,4-oxadiazol-2-yl)heptan-2-one?
The InChIKey is NAMTUZUNASLYSS-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16N2O2.C2H6/c1-8(13)6-4-3-5-7-10-12-11-9(2)14-10;1-2/h3-7H2,1-2H3;1-2H3.
What are the key properties of ethane;7-(5-methyl-1,3,4-oxadiazol-2-yl)heptan-2-one?
ethane;7-(5-methyl-1,3,4-oxadiazol-2-yl)heptan-2-one has a molecular weight of 226.32 g/mol, XLogP of 3.10, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;7-(5-methyl-1,3,4-oxadiazol-2-yl)heptan-2-one is sourced from PubChem (CID 167517152), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).