C9H14N2O — CID 163509088
2-methyl-5-[(Z)-3-methylpent-3-enyl]-1,3,4-oxadiazole (PubChem CID 163509088) has the molecular formula C9H14N2O and a molecular weight of 166.22 g/mol. Its IUPAC name is 2-methyl-5-[(Z)-3-methylpent-3-enyl]-1,3,4-oxadiazole.
| Compound Name | 2-methyl-5-[(Z)-3-methylpent-3-enyl]-1,3,4-oxadiazole |
|---|---|
| PubChem CID | 163509088 |
| Molecular Formula | C9H14N2O |
| Molecular Weight | 166.22 g/mol |
| Exact Mass | 166.11 |
| IUPAC Name | 2-methyl-5-[(Z)-3-methylpent-3-enyl]-1,3,4-oxadiazole |
| SMILES | C/C=C(/C)CCc1nnc(C)o1 |
| InChI | InChI=1S/C9H14N2O/c1-4-7(2)5-6-9-11-10-8(3)12-9/h4H,5-6H2,1-3H3/b7-4- |
| InChIKey | DBDASRREYRJERG-DAXSKMNVSA-N |
| XLogP | 2.28 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.22 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|