C10H17N3O2 — CID 60972938
4-[(4,5-dimethyl-1,3-oxazol-2-yl)methylamino]butanamide (PubChem CID 60972938) has the molecular formula C10H17N3O2 and a molecular weight of 211.26 g/mol. Its IUPAC name is 4-[(4,5-dimethyl-1,3-oxazol-2-yl)methylamino]butanamide.
| Compound Name | 4-[(4,5-dimethyl-1,3-oxazol-2-yl)methylamino]butanamide |
|---|---|
| PubChem CID | 60972938 |
| Molecular Formula | C10H17N3O2 |
| Molecular Weight | 211.26 g/mol |
| Exact Mass | 211.13 |
| IUPAC Name | 4-[(4,5-dimethyl-1,3-oxazol-2-yl)methylamino]butanamide |
| SMILES | Cc1nc(CNCCCC(N)=O)oc1C |
| InChI | InChI=1S/C10H17N3O2/c1-7-8(2)15-10(13-7)6-12-5-3-4-9(11)14/h12H,3-6H2,1-2H3,(H2,11,14) |
| InChIKey | NYYLOKRHTRMIRE-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 81.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.26 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|