C12H18N2O4 — CID 106370238
6-[(4,5-dimethyl-1,3-oxazol-2-yl)methylamino]-6-oxohexanoic acid (PubChem CID 106370238) has the molecular formula C12H18N2O4 and a molecular weight of 254.29 g/mol. Its IUPAC name is 6-[(4,5-dimethyl-1,3-oxazol-2-yl)methylamino]-6-oxohexanoic acid.
| Compound Name | 6-[(4,5-dimethyl-1,3-oxazol-2-yl)methylamino]-6-oxohexanoic acid |
|---|---|
| PubChem CID | 106370238 |
| Molecular Formula | C12H18N2O4 |
| Molecular Weight | 254.29 g/mol |
| Exact Mass | 254.13 |
| IUPAC Name | 6-[(4,5-dimethyl-1,3-oxazol-2-yl)methylamino]-6-oxohexanoic acid |
| SMILES | Cc1nc(CNC(=O)CCCCC(=O)O)oc1C |
| InChI | InChI=1S/C12H18N2O4/c1-8-9(2)18-11(14-8)7-13-10(15)5-3-4-6-12(16)17/h3-7H2,1-2H3,(H,13,15)(H,16,17) |
| InChIKey | SROVFMIWQBSOMJ-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 92.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.29 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|