C12H21N3O2 — CID 114180296
3-amino-N-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]hexanamide (PubChem CID 114180296) has the molecular formula C12H21N3O2 and a molecular weight of 239.32 g/mol. Its IUPAC name is 3-amino-N-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]hexanamide.
| Compound Name | 3-amino-N-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]hexanamide |
|---|---|
| PubChem CID | 114180296 |
| Molecular Formula | C12H21N3O2 |
| Molecular Weight | 239.32 g/mol |
| Exact Mass | 239.16 |
| IUPAC Name | 3-amino-N-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]hexanamide |
| SMILES | CCCC(N)CC(=O)NCc1nc(C)c(C)o1 |
| InChI | InChI=1S/C12H21N3O2/c1-4-5-10(13)6-11(16)14-7-12-15-8(2)9(3)17-12/h10H,4-7,13H2,1-3H3,(H,14,16) |
| InChIKey | UMDQWABKTLQGQC-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 81.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.32 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |